About tris(lead(2+));bis(oxygen(2-));phthalate
tris(lead(2+));bis(oxygen(2-));phthalate (PubChem CID 90659577) has the molecular formula C8H4O6Pb3
and a molecular weight of 817.71 g/mol. Its IUPAC name is tris(lead(2+));bis(oxygen(2-));phthalate.
Molecular Properties
| Compound Name | tris(lead(2+));bis(oxygen(2-));phthalate |
| PubChem CID | 90659577 |
| Molecular Formula | C8H4O6Pb3 |
| Molecular Weight | 817.71 g/mol |
| Exact Mass | 819.93 |
| IUPAC Name | tris(lead(2+));bis(oxygen(2-));phthalate |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].[O-2].[O-2].[Pb+2].[Pb+2].[Pb+2] |
| InChI | InChI=1S/C8H6O4.2O.3Pb/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;;/h1-4H,(H,9,10)(H,11,12);;;;;/q;2*-2;3*+2/p-2 |
| InChIKey | LCMZLEGVLPHFGA-UHFFFAOYSA-L |
| XLogP | -2.97 |
| TPSA | 137.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 817.71 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tris(lead(2+));bis(oxygen(2-));phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(lead(2+));bis(oxygen(2-));phthalate?
The IUPAC name of tris(lead(2+));bis(oxygen(2-));phthalate (CID 90659577) is tris(lead(2+));bis(oxygen(2-));phthalate.
What is the SMILES notation for tris(lead(2+));bis(oxygen(2-));phthalate?
The canonical SMILES for tris(lead(2+));bis(oxygen(2-));phthalate is O=C([O-])c1ccccc1C(=O)[O-].[O-2].[O-2].[Pb+2].[Pb+2].[Pb+2].
What is the InChIKey of tris(lead(2+));bis(oxygen(2-));phthalate?
The InChIKey is LCMZLEGVLPHFGA-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.2O.3Pb/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;;/h1-4H,(H,9,10)(H,11,12);;;;;/q;2*-2;3*+2/p-2.
What are the key properties of tris(lead(2+));bis(oxygen(2-));phthalate?
tris(lead(2+));bis(oxygen(2-));phthalate has a molecular weight of 817.71 g/mol, XLogP of -2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris(lead(2+));bis(oxygen(2-));phthalate is sourced from PubChem (CID 90659577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).