C26H36O4S — CID 90661039
(1S,2R,5Z,10R,11S,12R,16S)-2-hydroxy-2,6,10-trimethyl-15-(phenylsulfanylmethyl)-13,18-dioxatricyclo[9.6.1.012,16]octadec-5-en-14-one (PubChem CID 90661039) has the molecular formula C26H36O4S and a molecular weight of 444.64 g/mol. Its IUPAC name is (1S,2R,5Z,10R,11S,12R,16S)-2-hydroxy-2,6,10-trimethyl-15-(phenylsulfanylmethyl)-13,18-dioxatricyclo[9.6.1.012,16]octadec-5-en-14-one.
| Compound Name | (1S,2R,5Z,10R,11S,12R,16S)-2-hydroxy-2,6,10-trimethyl-15-(phenylsulfanylmethyl)-13,18-dioxatricyclo[9.6.1.012,16]octadec-5-en-14-one |
|---|---|
| PubChem CID | 90661039 |
| Molecular Formula | C26H36O4S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (1S,2R,5Z,10R,11S,12R,16S)-2-hydroxy-2,6,10-trimethyl-15-(phenylsulfanylmethyl)-13,18-dioxatricyclo[9.6.1.012,16]octadec-5-en-14-one |
| SMILES | C/C1=C/CC[C@@](C)(O)[C@@H]2C[C@H]3C(CSc4ccccc4)C(=O)O[C@H]3[C@@H](O2)[C@H](C)CCC1 |
| InChI | InChI=1S/C26H36O4S/c1-17-9-7-11-18(2)23-24-20(15-22(29-23)26(3,28)14-8-10-17)21(25(27)30-24)16-31-19-12-5-4-6-13-19/h4-6,10,12-13,18,20-24,28H,7-9,11,14-16H2,1-3H3/b17-10-/t18-,20+,21?,22+,23+,24-,26-/m1/s1 |
| InChIKey | KAWKSVZQTQFMCS-BCTMPGGHSA-N |
| XLogP | 5.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|