C19H28INO — CID 90661549
10-methoxy-7,7-dimethyl-2,3,4,5,6,7a,8,12b-octahydro-1H-phenanthro[9,8a-b]pyrrol-7-ium iodide (PubChem CID 90661549) has the molecular formula C19H28INO and a molecular weight of 413.34 g/mol. Its IUPAC name is 10-methoxy-7,7-dimethyl-2,3,4,5,6,7a,8,12b-octahydro-1H-phenanthro[9,8a-b]pyrrol-7-ium iodide.
| Compound Name | 10-methoxy-7,7-dimethyl-2,3,4,5,6,7a,8,12b-octahydro-1H-phenanthro[9,8a-b]pyrrol-7-ium iodide |
|---|---|
| PubChem CID | 90661549 |
| Molecular Formula | C19H28INO |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 10-methoxy-7,7-dimethyl-2,3,4,5,6,7a,8,12b-octahydro-1H-phenanthro[9,8a-b]pyrrol-7-ium iodide |
| SMILES | COc1ccc2c(c1)CC1C3(CCCCC23)CC[N+]1(C)C.[I-] |
| InChI | InChI=1S/C19H28NO.HI/c1-20(2)11-10-19-9-5-4-6-17(19)16-8-7-15(21-3)12-14(16)13-18(19)20;/h7-8,12,17-18H,4-6,9-11,13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DHOPWCGLQBRYCJ-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|