C26H41NO7 — CID 90661717
(1S,4S,5S,6S,8R,12S,13S,16S,19S,21S)-14-ethyl-4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosan-21-ol (PubChem CID 90661717) has the molecular formula C26H41NO7 and a molecular weight of 479.61 g/mol. Its IUPAC name is (1S,4S,5S,6S,8R,12S,13S,16S,19S,21S)-14-ethyl-4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosan-21-ol.
| Compound Name | (1S,4S,5S,6S,8R,12S,13S,16S,19S,21S)-14-ethyl-4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosan-21-ol |
|---|---|
| PubChem CID | 90661717 |
| Molecular Formula | C26H41NO7 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (1S,4S,5S,6S,8R,12S,13S,16S,19S,21S)-14-ethyl-4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosan-21-ol |
| SMILES | CCN1C[C@]2(COC)CC[C@H](OC)[C@@]34C5C[C@@H]6C(OC)C5[C@@]5(C[C@@H]6OC)OCO[C@]5(C(O)C23)[C@@H]14 |
| InChI | InChI=1S/C26H41NO7/c1-6-27-11-23(12-29-2)8-7-17(31-4)25-15-9-14-16(30-3)10-24(18(15)19(14)32-5)26(22(25)27,34-13-33-24)21(28)20(23)25/h14-22,28H,6-13H2,1-5H3/t14-,15?,16-,17-,18?,19?,20?,21?,22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | XTLROSDJDZHIIK-XNZYKSRWSA-N |
| XLogP | 1.29 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |