C23H28O9 — CID 90661844
8-O-ethyl 7-O-methyl (7S,8R,12R,16R)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-9-ene-14,1'-cyclohexane]-7,8-dicarboxylate (PubChem CID 90661844) has the molecular formula C23H28O9 and a molecular weight of 448.47 g/mol. Its IUPAC name is 8-O-ethyl 7-O-methyl (7S,8R,12R,16R)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-9-ene-14,1'-cyclohexane]-7,8-dicarboxylate.
| Compound Name | 8-O-ethyl 7-O-methyl (7S,8R,12R,16R)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-9-ene-14,1'-cyclohexane]-7,8-dicarboxylate |
|---|---|
| PubChem CID | 90661844 |
| Molecular Formula | C23H28O9 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 8-O-ethyl 7-O-methyl (7S,8R,12R,16R)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-9-ene-14,1'-cyclohexane]-7,8-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C2O[C@@H]3OC4(CCCCC4)O[C@@H]3C2C2C(=O)CCC(=O)[C@]21C(=O)OC |
| InChI | InChI=1S/C23H28O9/c1-3-29-19(26)12-11-14-16(17-13(24)7-8-15(25)23(12,17)21(27)28-2)18-20(30-14)32-22(31-18)9-5-4-6-10-22/h11-12,16-18,20H,3-10H2,1-2H3/t12-,16?,17?,18+,20+,23-/m0/s1 |
| InChIKey | YXZXPVCRLFOQHP-SLKFQVDJSA-N |
| XLogP | 1.82 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|