C14H20O2 — CID 90661865
(1R,5R,8S)-5-ethyl-7,7-dimethyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one (PubChem CID 90661865) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1R,5R,8S)-5-ethyl-7,7-dimethyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one.
| Compound Name | (1R,5R,8S)-5-ethyl-7,7-dimethyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one |
|---|---|
| PubChem CID | 90661865 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1R,5R,8S)-5-ethyl-7,7-dimethyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one |
| SMILES | CC[C@@]12CCC[C@@]13C=C[C@H](O3)C(C)(C)C2=O |
| InChI | InChI=1S/C14H20O2/c1-4-13-7-5-8-14(13)9-6-10(16-14)12(2,3)11(13)15/h6,9-10H,4-5,7-8H2,1-3H3/t10-,13-,14+/m0/s1 |
| InChIKey | NRZCFVLKRLYNNH-LEWSCRJBSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|