C23H26O9 — CID 90661869
methyl (2R,7R,8R,12R,16R)-8-(acetyloxymethyl)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate (PubChem CID 90661869) has the molecular formula C23H26O9 and a molecular weight of 446.45 g/mol. Its IUPAC name is methyl (2R,7R,8R,12R,16R)-8-(acetyloxymethyl)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate.
| Compound Name | methyl (2R,7R,8R,12R,16R)-8-(acetyloxymethyl)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate |
|---|---|
| PubChem CID | 90661869 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl (2R,7R,8R,12R,16R)-8-(acetyloxymethyl)-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)C=CC(=O)[C@@H]1C1C(=C[C@H]2COC(C)=O)O[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C23H26O9/c1-12(24)29-11-13-10-15-17(18-14(25)6-7-16(26)23(13,18)21(27)28-2)19-20(30-15)32-22(31-19)8-4-3-5-9-22/h6-7,10,13,17-20H,3-5,8-9,11H2,1-2H3/t13-,17?,18+,19+,20+,23-/m0/s1 |
| InChIKey | YNVMSYNFAFJFSE-VAXFERILSA-N |
| XLogP | 1.60 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|