C22H25NO5 — CID 90661902
benzyl (2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 90661902) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is benzyl (2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 90661902 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | benzyl (2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CO[C@@H]1O[C@H]2CCN(C(=O)OCc3ccccc3)[C@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO5/c1-25-21-20(26-14-16-8-4-2-5-9-16)19-18(28-21)12-13-23(19)22(24)27-15-17-10-6-3-7-11-17/h2-11,18-21H,12-15H2,1H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | CKBNYTXRUSOIJZ-DOIPELPJSA-N |
| XLogP | 3.35 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |