C11H15NO6 — CID 90662145
methyl (3R,3aS,4R,6aR)-3a-hydroxy-1,3,4-trimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrole-6a-carboxylate (PubChem CID 90662145) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is methyl (3R,3aS,4R,6aR)-3a-hydroxy-1,3,4-trimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrole-6a-carboxylate.
| Compound Name | methyl (3R,3aS,4R,6aR)-3a-hydroxy-1,3,4-trimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 90662145 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | methyl (3R,3aS,4R,6aR)-3a-hydroxy-1,3,4-trimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrole-6a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)O[C@H](C)[C@]1(O)[C@@H](C)C(=O)N2C |
| InChI | InChI=1S/C11H15NO6/c1-5-7(13)12(3)10(8(14)17-4)9(15)18-6(2)11(5,10)16/h5-6,16H,1-4H3/t5-,6+,10+,11+/m0/s1 |
| InChIKey | GXDBIVNVLFHXQZ-SFBOQDPRSA-N |
| XLogP | -1.32 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|