C11H16O5 — CID 90662163
(3aR,8aS,8bR)-8a-hydroxy-2,2-dimethyl-3a,4a,5,6,8,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-one (PubChem CID 90662163) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3aR,8aS,8bR)-8a-hydroxy-2,2-dimethyl-3a,4a,5,6,8,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-one.
| Compound Name | (3aR,8aS,8bR)-8a-hydroxy-2,2-dimethyl-3a,4a,5,6,8,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-one |
|---|---|
| PubChem CID | 90662163 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3aR,8aS,8bR)-8a-hydroxy-2,2-dimethyl-3a,4a,5,6,8,8b-hexahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-one |
| SMILES | CC1(C)O[C@H]2OC3CCC(=O)C[C@@]3(O)[C@H]2O1 |
| InChI | InChI=1S/C11H16O5/c1-10(2)15-8-9(16-10)14-7-4-3-6(12)5-11(7,8)13/h7-9,13H,3-5H2,1-2H3/t7?,8-,9+,11-/m0/s1 |
| InChIKey | CIZJVNWLOIYUJC-GCLMCXFESA-N |
| XLogP | 0.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |