(2S,3R)-3-phenyloxirane-2-carboxylic acid

C9H8O3 — CID 906622

IUPAC(2S,3R)-3-phenyloxirane-2-carboxylic acid
SMILESO=C(O)[C@H]1O[C@@H]1c1ccccc1
InChIInChI=1S/C9H8O3/c10-9(11)8-7(12-8)6-4-2-1-3-5-6/h1-5,7-8H,(H,10,11)/t7-,8+/m1/s1
InChIKeyHALONVPKHYIEQU-SFYZADRCSA-N
MW164.16 g/mol
LogP1.21
Rot. Bonds2

About (2S,3R)-3-phenyloxirane-2-carboxylic acid

(2S,3R)-3-phenyloxirane-2-carboxylic acid (PubChem CID 906622) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is (2S,3R)-3-phenyloxirane-2-carboxylic acid.

Molecular Properties

Compound Name(2S,3R)-3-phenyloxirane-2-carboxylic acid
PubChem CID906622
Molecular FormulaC9H8O3
Molecular Weight164.16 g/mol
Exact Mass164.05
IUPAC Name(2S,3R)-3-phenyloxirane-2-carboxylic acid
SMILESO=C(O)[C@H]1O[C@@H]1c1ccccc1
InChIInChI=1S/C9H8O3/c10-9(11)8-7(12-8)6-4-2-1-3-5-6/h1-5,7-8H,(H,10,11)/t7-,8+/m1/s1
InChIKeyHALONVPKHYIEQU-SFYZADRCSA-N
XLogP1.21
TPSA49.83 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.16
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze (2S,3R)-3-phenyloxirane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R)-3-phenyloxirane-2-carboxylic acid?
The IUPAC name of (2S,3R)-3-phenyloxirane-2-carboxylic acid (CID 906622) is (2S,3R)-3-phenyloxirane-2-carboxylic acid.
What is the SMILES notation for (2S,3R)-3-phenyloxirane-2-carboxylic acid?
The canonical SMILES for (2S,3R)-3-phenyloxirane-2-carboxylic acid is O=C(O)[C@H]1O[C@@H]1c1ccccc1.
What is the InChIKey of (2S,3R)-3-phenyloxirane-2-carboxylic acid?
The InChIKey is HALONVPKHYIEQU-SFYZADRCSA-N. The full InChI is InChI=1S/C9H8O3/c10-9(11)8-7(12-8)6-4-2-1-3-5-6/h1-5,7-8H,(H,10,11)/t7-,8+/m1/s1.
What are the key properties of (2S,3R)-3-phenyloxirane-2-carboxylic acid?
(2S,3R)-3-phenyloxirane-2-carboxylic acid has a molecular weight of 164.16 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-phenyloxirane-2-carboxylic acid is sourced from PubChem (CID 906622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).