C37H58N2O5Si — CID 90662265
(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;N-cyclohexylcyclohexanamine (PubChem CID 90662265) has the molecular formula C37H58N2O5Si and a molecular weight of 638.97 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;N-cyclohexylcyclohexanamine.
| Compound Name | (2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;N-cyclohexylcyclohexanamine |
|---|---|
| PubChem CID | 90662265 |
| Molecular Formula | C37H58N2O5Si |
| Molecular Weight | 638.97 g/mol |
| Exact Mass | 638.41 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;N-cyclohexylcyclohexanamine |
| SMILES | C1CCC(NC2CCCCC2)CC1.C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C25H35NO5Si.C12H23N/c1-18(21(22(27)28)26-23(29)30-24(2,3)4)31-32(25(5,6)7,19-14-10-8-11-15-19)20-16-12-9-13-17-20;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h8-18,21H,1-7H3,(H,26,29)(H,27,28);11-13H,1-10H2/t18-,21+;/m1./s1 |
| InChIKey | KNBMLDQTPPKPAZ-WKOQGQMTSA-N |
| XLogP | 7.17 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.97 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|