C16H22O4 — CID 90662285
methyl (3aR,4S,8aR)-1-acetyl-2-ethyl-3-oxo-4,5,6,7,8,8a-hexahydro-3aH-azulene-4-carboxylate (PubChem CID 90662285) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl (3aR,4S,8aR)-1-acetyl-2-ethyl-3-oxo-4,5,6,7,8,8a-hexahydro-3aH-azulene-4-carboxylate.
| Compound Name | methyl (3aR,4S,8aR)-1-acetyl-2-ethyl-3-oxo-4,5,6,7,8,8a-hexahydro-3aH-azulene-4-carboxylate |
|---|---|
| PubChem CID | 90662285 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methyl (3aR,4S,8aR)-1-acetyl-2-ethyl-3-oxo-4,5,6,7,8,8a-hexahydro-3aH-azulene-4-carboxylate |
| SMILES | CCC1=C(C(C)=O)[C@@H]2CCCC[C@H](C(=O)OC)[C@@H]2C1=O |
| InChI | InChI=1S/C16H22O4/c1-4-10-13(9(2)17)11-7-5-6-8-12(16(19)20-3)14(11)15(10)18/h11-12,14H,4-8H2,1-3H3/t11-,12-,14+/m0/s1 |
| InChIKey | YWXVYOWSAKMTHO-SGMGOOAPSA-N |
| XLogP | 2.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |