C14H20O3 — CID 90662294
(5'S,8'aS)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-4a,5,7,8-tetrahydro-4H-naphthalene]-1'-one (PubChem CID 90662294) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (5'S,8'aS)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-4a,5,7,8-tetrahydro-4H-naphthalene]-1'-one.
| Compound Name | (5'S,8'aS)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-4a,5,7,8-tetrahydro-4H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 90662294 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (5'S,8'aS)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-4a,5,7,8-tetrahydro-4H-naphthalene]-1'-one |
| SMILES | C[C@H]1C2CC=CC(=O)[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C14H20O3/c1-10-11-4-3-5-12(15)13(11,2)6-7-14(10)16-8-9-17-14/h3,5,10-11H,4,6-9H2,1-2H3/t10-,11?,13-/m0/s1 |
| InChIKey | ZFKCZDPYSCMLMP-BJEKPXQXSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |