C30H31NO7 — CID 90662439
1-O-benzyl 5-O-methyl 2-(1-hydroxyethyl)-3-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]pentanedioate (PubChem CID 90662439) has the molecular formula C30H31NO7 and a molecular weight of 517.58 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl 2-(1-hydroxyethyl)-3-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]pentanedioate.
| Compound Name | 1-O-benzyl 5-O-methyl 2-(1-hydroxyethyl)-3-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]pentanedioate |
|---|---|
| PubChem CID | 90662439 |
| Molecular Formula | C30H31NO7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 1-O-benzyl 5-O-methyl 2-(1-hydroxyethyl)-3-[(4S,5R)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]pentanedioate |
| SMILES | COC(=O)CC(C(C(=O)OCc1ccccc1)C(C)O)N1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H31NO7/c1-20(32)26(29(34)37-19-21-12-6-3-7-13-21)24(18-25(33)36-2)31-27(22-14-8-4-9-15-22)28(38-30(31)35)23-16-10-5-11-17-23/h3-17,20,24,26-28,32H,18-19H2,1-2H3/t20?,24?,26?,27-,28+/m0/s1 |
| InChIKey | XMOIYHJTZCPCDL-RAXPXQGCSA-N |
| XLogP | 4.59 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|