C21H24O7 — CID 90662477
methyl (7R,8S)-8-methyl-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate (PubChem CID 90662477) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl (7R,8S)-8-methyl-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate.
| Compound Name | methyl (7R,8S)-8-methyl-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate |
|---|---|
| PubChem CID | 90662477 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl (7R,8S)-8-methyl-3,6-dioxospiro[11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-14,1'-cyclohexane]-7-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)C=CC(=O)C1C1C(=C[C@@H]2C)OC2OC3(CCCCC3)OC21 |
| InChI | InChI=1S/C21H24O7/c1-11-10-13-15(16-12(22)6-7-14(23)21(11,16)19(24)25-2)17-18(26-13)28-20(27-17)8-4-3-5-9-20/h6-7,10-11,15-18H,3-5,8-9H2,1-2H3/t11-,15?,16?,17?,18?,21-/m0/s1 |
| InChIKey | UEKFZHGANHISGR-KWNQETLBSA-N |
| XLogP | 2.05 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|