C30H44O2 — CID 90662491
(3'R,5'Z,8Z,11S)-6',8-dimethyl-3',11-bis(prop-1-en-2-yl)spiro[3,4,5,6,7,10,11,12-octahydrocyclodeca[b]pyran-2,10'-cyclodec-5-ene]-1'-one (PubChem CID 90662491) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is (3'R,5'Z,8Z,11S)-6',8-dimethyl-3',11-bis(prop-1-en-2-yl)spiro[3,4,5,6,7,10,11,12-octahydrocyclodeca[b]pyran-2,10'-cyclodec-5-ene]-1'-one.
| Compound Name | (3'R,5'Z,8Z,11S)-6',8-dimethyl-3',11-bis(prop-1-en-2-yl)spiro[3,4,5,6,7,10,11,12-octahydrocyclodeca[b]pyran-2,10'-cyclodec-5-ene]-1'-one |
|---|---|
| PubChem CID | 90662491 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (3'R,5'Z,8Z,11S)-6',8-dimethyl-3',11-bis(prop-1-en-2-yl)spiro[3,4,5,6,7,10,11,12-octahydrocyclodeca[b]pyran-2,10'-cyclodec-5-ene]-1'-one |
| SMILES | C=C(C)[C@@H]1C/C=C(/C)CCCC2(CCC3=C(C[C@@H](C(=C)C)C/C=C(/C)CCC3)O2)C(=O)C1 |
| InChI | InChI=1S/C30H44O2/c1-21(2)26-14-12-23(5)9-7-11-25-16-18-30(32-28(25)19-26)17-8-10-24(6)13-15-27(22(3)4)20-29(30)31/h12-13,26-27H,1,3,7-11,14-20H2,2,4-6H3/b23-12-,24-13-/t26-,27+,30?/m0/s1 |
| InChIKey | DMKVPFLNEBAOOV-CCJVWLITSA-N |
| XLogP | 8.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|