C20H31NO2 — CID 906626
(3S)-4-methyl-1-piperidin-1-yl-3-(4-propan-2-yloxyphenyl)pentan-1-one (PubChem CID 906626) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (3S)-4-methyl-1-piperidin-1-yl-3-(4-propan-2-yloxyphenyl)pentan-1-one.
| Compound Name | (3S)-4-methyl-1-piperidin-1-yl-3-(4-propan-2-yloxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 906626 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (3S)-4-methyl-1-piperidin-1-yl-3-(4-propan-2-yloxyphenyl)pentan-1-one |
| SMILES | CC(C)Oc1ccc([C@@H](CC(=O)N2CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C20H31NO2/c1-15(2)19(14-20(22)21-12-6-5-7-13-21)17-8-10-18(11-9-17)23-16(3)4/h8-11,15-16,19H,5-7,12-14H2,1-4H3/t19-/m0/s1 |
| InChIKey | WXLJHPWRAQERJU-IBGZPJMESA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |