C10H10N2O2 — CID 90662612
(2S,3R,4R)-3,4-dihydroxy-1,2,3,4-tetrahydroquinoline-2-carbonitrile (PubChem CID 90662612) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2S,3R,4R)-3,4-dihydroxy-1,2,3,4-tetrahydroquinoline-2-carbonitrile.
| Compound Name | (2S,3R,4R)-3,4-dihydroxy-1,2,3,4-tetrahydroquinoline-2-carbonitrile |
|---|---|
| PubChem CID | 90662612 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (2S,3R,4R)-3,4-dihydroxy-1,2,3,4-tetrahydroquinoline-2-carbonitrile |
| SMILES | N#C[C@@H]1Nc2ccccc2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H10N2O2/c11-5-8-10(14)9(13)6-3-1-2-4-7(6)12-8/h1-4,8-10,12-14H/t8-,9+,10+/m0/s1 |
| InChIKey | OBJPMGDLUHXDBS-IVZWLZJFSA-N |
| XLogP | 0.40 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |