C20H29N3O8 — CID 90662907
(2S,4R,5R,6R)-6-[(1S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-1-hydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid (PubChem CID 90662907) has the molecular formula C20H29N3O8 and a molecular weight of 439.47 g/mol. Its IUPAC name is (2S,4R,5R,6R)-6-[(1S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-1-hydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,4R,5R,6R)-6-[(1S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-1-hydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90662907 |
| Molecular Formula | C20H29N3O8 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (2S,4R,5R,6R)-6-[(1S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]-1-hydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)NC[C@H](O)[C@H]1O[C@H](C(=O)O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H29N3O8/c1-10(23-19(28)12(21)7-11-5-3-2-4-6-11)18(27)22-9-14(25)17-16(26)13(24)8-15(31-17)20(29)30/h2-6,10,12-17,24-26H,7-9,21H2,1H3,(H,22,27)(H,23,28)(H,29,30)/t10-,12-,13+,14-,15-,16+,17+/m0/s1 |
| InChIKey | HQYRUUIMTSKVMX-AKEOTLKHSA-N |
| XLogP | -2.50 |
| TPSA | 191.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |