C19H22BrFN5O7P — CID 90663258
3-[(2R,4S,5R)-5-[[benzotriazol-1-yloxy-[2-bromoethyl(methyl)amino]phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoro-3H-pyridine-2,6-dione (PubChem CID 90663258) has the molecular formula C19H22BrFN5O7P and a molecular weight of 562.29 g/mol. Its IUPAC name is 3-[(2R,4S,5R)-5-[[benzotriazol-1-yloxy-[2-bromoethyl(methyl)amino]phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoro-3H-pyridine-2,6-dione.
| Compound Name | 3-[(2R,4S,5R)-5-[[benzotriazol-1-yloxy-[2-bromoethyl(methyl)amino]phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoro-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 90663258 |
| Molecular Formula | C19H22BrFN5O7P |
| Molecular Weight | 562.29 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 3-[(2R,4S,5R)-5-[[benzotriazol-1-yloxy-[2-bromoethyl(methyl)amino]phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoro-3H-pyridine-2,6-dione |
| SMILES | CN(CCBr)P(=O)(OC[C@H]1O[C@@H](C2C=C(F)C(=O)NC2=O)C[C@@H]1O)On1nnc2ccccc21 |
| InChI | InChI=1S/C19H22BrFN5O7P/c1-25(7-6-20)34(30,33-26-14-5-3-2-4-13(14)23-24-26)31-10-17-15(27)9-16(32-17)11-8-12(21)19(29)22-18(11)28/h2-5,8,11,15-17,27H,6-7,9-10H2,1H3,(H,22,28,29)/t11?,15-,16+,17+,34?/m0/s1 |
| InChIKey | KRYAPJXTAIMDIU-JVQXESPWSA-N |
| XLogP | 0.96 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|