C32H32N2O8 — CID 90663494
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxo-1,3-diazocan-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 90663494) has the molecular formula C32H32N2O8 and a molecular weight of 572.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxo-1,3-diazocan-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxo-1,3-diazocan-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90663494 |
| Molecular Formula | C32H32N2O8 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxo-1,3-diazocan-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](N2CCCCCNC2=O)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O8/c35-29(22-13-5-1-6-14-22)39-21-25-26(41-30(36)23-15-7-2-8-16-23)27(42-31(37)24-17-9-3-10-18-24)28(40-25)34-20-12-4-11-19-33-32(34)38/h1-3,5-10,13-18,25-28H,4,11-12,19-21H2,(H,33,38)/t25-,26-,27-,28-/m1/s1 |
| InChIKey | XXSAMXZUKQWVMB-BIYDSLDMSA-N |
| XLogP | 4.22 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|