C29H26N2O8 — CID 90663495
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxoimidazolidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 90663495) has the molecular formula C29H26N2O8 and a molecular weight of 530.53 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxoimidazolidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxoimidazolidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90663495 |
| Molecular Formula | C29H26N2O8 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-oxoimidazolidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](N2CCNC2=O)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O8/c32-26(19-10-4-1-5-11-19)36-18-22-23(38-27(33)20-12-6-2-7-13-20)24(25(37-22)31-17-16-30-29(31)35)39-28(34)21-14-8-3-9-15-21/h1-15,22-25H,16-18H2,(H,30,35)/t22-,23-,24-,25-/m1/s1 |
| InChIKey | RGDFLTPTYRPMKD-ZGFBMJKBSA-N |
| XLogP | 3.04 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|