C15H17N2O8P — CID 90663787
[(2R,3S,5R)-5-(2,4-dioxo-5-phenylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90663787) has the molecular formula C15H17N2O8P and a molecular weight of 384.28 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2,4-dioxo-5-phenylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(2,4-dioxo-5-phenylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90663787 |
| Molecular Formula | C15H17N2O8P |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | [(2R,3S,5R)-5-(2,4-dioxo-5-phenylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)cc1-c1ccccc1 |
| InChI | InChI=1S/C15H17N2O8P/c18-11-6-13(25-12(11)8-24-26(21,22)23)17-7-10(14(19)16-15(17)20)9-4-2-1-3-5-9/h1-5,7,11-13,18H,6,8H2,(H,16,19,20)(H2,21,22,23)/t11-,12+,13+/m0/s1 |
| InChIKey | TUPJWUPSLFJGQR-YNEHKIRRSA-N |
| XLogP | -0.04 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|