About N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride
N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride (PubChem CID 90664279) has the molecular formula C24H30Cl2N4
and a molecular weight of 445.44 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride |
| PubChem CID | 90664279 |
| Molecular Formula | C24H30Cl2N4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CN2CCC(CCNc3ccc(-c4ccccc4)nn3)CC2)cc1 |
| InChI | InChI=1S/C24H28N4.2ClH/c1-3-7-21(8-4-1)19-28-17-14-20(15-18-28)13-16-25-24-12-11-23(26-27-24)22-9-5-2-6-10-22;;/h1-12,20H,13-19H2,(H,25,27);2*1H |
| InChIKey | WDWFCIJAURUIPR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride?
The IUPAC name of N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride (CID 90664279) is N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride.
What is the SMILES notation for N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride?
The canonical SMILES for N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride is Cl.Cl.c1ccc(CN2CCC(CCNc3ccc(-c4ccccc4)nn3)CC2)cc1.
What is the InChIKey of N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride?
The InChIKey is WDWFCIJAURUIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4.2ClH/c1-3-7-21(8-4-1)19-28-17-14-20(15-18-28)13-16-25-24-12-11-23(26-27-24)22-9-5-2-6-10-22;;/h1-12,20H,13-19H2,(H,25,27);2*1H.
What are the key properties of N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride?
N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride has a molecular weight of 445.44 g/mol, XLogP of 5.70, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-phenylpyridazin-3-amine;dihydrochloride is sourced from PubChem (CID 90664279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).