C22H28Cl2N4O2 — CID 90664295
2-[3-[4-[3-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]butoxy]phenyl]-4,5-dihydro-1H-imidazole;dihydrochloride (PubChem CID 90664295) has the molecular formula C22H28Cl2N4O2 and a molecular weight of 451.40 g/mol. Its IUPAC name is 2-[3-[4-[3-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]butoxy]phenyl]-4,5-dihydro-1H-imidazole;dihydrochloride.
| Compound Name | 2-[3-[4-[3-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]butoxy]phenyl]-4,5-dihydro-1H-imidazole;dihydrochloride |
|---|---|
| PubChem CID | 90664295 |
| Molecular Formula | C22H28Cl2N4O2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[3-[4-[3-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]butoxy]phenyl]-4,5-dihydro-1H-imidazole;dihydrochloride |
| SMILES | Cl.Cl.c1cc(OCCCCOc2cccc(C3=NCCN3)c2)cc(C2=NCCN2)c1 |
| InChI | InChI=1S/C22H26N4O2.2ClH/c1(13-27-19-7-3-5-17(15-19)21-23-9-10-24-21)2-14-28-20-8-4-6-18(16-20)22-25-11-12-26-22;;/h3-8,15-16H,1-2,9-14H2,(H,23,24)(H,25,26);2*1H |
| InChIKey | QQHSTKADOIUNBP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|