About N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride
N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride (PubChem CID 90664335) has the molecular formula C20H26Cl2N4S
and a molecular weight of 425.43 g/mol. Its IUPAC name is N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride.
Molecular Properties
| Compound Name | N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride |
| PubChem CID | 90664335 |
| Molecular Formula | C20H26Cl2N4S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\c1ccc2c(ccn2CCN2CCCCC2)c1)c1cccs1 |
| InChI | InChI=1S/C20H24N4S.2ClH/c21-20(19-5-4-14-25-19)22-17-6-7-18-16(15-17)8-11-24(18)13-12-23-9-2-1-3-10-23;;/h4-8,11,14-15H,1-3,9-10,12-13H2,(H2,21,22);2*1H |
| InChIKey | WWRWARWFJOJYAG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride?
The IUPAC name of N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride (CID 90664335) is N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride.
What is the SMILES notation for N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride?
The canonical SMILES for N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride is Cl.Cl.N/C(=N\c1ccc2c(ccn2CCN2CCCCC2)c1)c1cccs1.
What is the InChIKey of N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride?
The InChIKey is WWRWARWFJOJYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4S.2ClH/c21-20(19-5-4-14-25-19)22-17-6-7-18-16(15-17)8-11-24(18)13-12-23-9-2-1-3-10-23;;/h4-8,11,14-15H,1-3,9-10,12-13H2,(H2,21,22);2*1H.
What are the key properties of N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride?
N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride has a molecular weight of 425.43 g/mol, XLogP of 5.07, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(2-piperidin-1-ylethyl)indol-5-yl]thiophene-2-carboximidamide;dihydrochloride is sourced from PubChem (CID 90664335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).