About 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride (PubChem CID 90664344) has the molecular formula C12H16Cl2N4
and a molecular weight of 287.19 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride |
| PubChem CID | 90664344 |
| Molecular Formula | C12H16Cl2N4 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride |
| SMILES | Cc1nn(CC2=NCCN2)c2ccccc12.Cl.Cl |
| InChI | InChI=1S/C12H14N4.2ClH/c1-9-10-4-2-3-5-11(10)16(15-9)8-12-13-6-7-14-12;;/h2-5H,6-8H2,1H3,(H,13,14);2*1H |
| InChIKey | ZDKYGPOYBJIQOR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride (CID 90664344) is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride is Cc1nn(CC2=NCCN2)c2ccccc12.Cl.Cl.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride?
The InChIKey is ZDKYGPOYBJIQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4.2ClH/c1-9-10-4-2-3-5-11(10)16(15-9)8-12-13-6-7-14-12;;/h2-5H,6-8H2,1H3,(H,13,14);2*1H.
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride?
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride has a molecular weight of 287.19 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-methylindazole;dihydrochloride is sourced from PubChem (CID 90664344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).