C23H32Cl2N6 — CID 90664399
N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]pentane-1,5-diamine;dihydrochloride (PubChem CID 90664399) has the molecular formula C23H32Cl2N6 and a molecular weight of 463.46 g/mol. Its IUPAC name is N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]pentane-1,5-diamine;dihydrochloride.
| Compound Name | N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]pentane-1,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 90664399 |
| Molecular Formula | C23H32Cl2N6 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]pentane-1,5-diamine;dihydrochloride |
| SMILES | Cl.Cl.c1cc(C2=NCCN2)ccc1NCCCCCNc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C23H30N6.2ClH/c1(2-12-24-20-8-4-18(5-9-20)22-26-14-15-27-22)3-13-25-21-10-6-19(7-11-21)23-28-16-17-29-23;;/h4-11,24-25H,1-3,12-17H2,(H,26,27)(H,28,29);2*1H |
| InChIKey | WKHKGEYTVUZGJB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|