About 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride
7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride (PubChem CID 90664435) has the molecular formula C16H17Cl6N3
and a molecular weight of 464.05 g/mol. Its IUPAC name is 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride.
Molecular Properties
| Compound Name | 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride |
| PubChem CID | 90664435 |
| Molecular Formula | C16H17Cl6N3 |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.Nc1nccc2ccc(NCc3ccc(Cl)c(Cl)c3)cc12 |
| InChI | InChI=1S/C16H13Cl2N3.4ClH/c17-14-4-1-10(7-15(14)18)9-21-12-3-2-11-5-6-20-16(19)13(11)8-12;;;;/h1-8,21H,9H2,(H2,19,20);4*1H |
| InChIKey | NXZSLTIGATVASE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride?
The IUPAC name of 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride (CID 90664435) is 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride.
What is the SMILES notation for 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride?
The canonical SMILES for 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride is Cl.Cl.Cl.Cl.Nc1nccc2ccc(NCc3ccc(Cl)c(Cl)c3)cc12.
What is the InChIKey of 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride?
The InChIKey is NXZSLTIGATVASE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N3.4ClH/c17-14-4-1-10(7-15(14)18)9-21-12-3-2-11-5-6-20-16(19)13(11)8-12;;;;/h1-8,21H,9H2,(H2,19,20);4*1H.
What are the key properties of 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride?
7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride has a molecular weight of 464.05 g/mol, XLogP of 6.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N-[(3,4-dichlorophenyl)methyl]isoquinoline-1,7-diamine;tetrahydrochloride is sourced from PubChem (CID 90664435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).