C25H29Cl2N3O3 — CID 90664576
6-[(5R)-5,9-diamino-4-oxononyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride (PubChem CID 90664576) has the molecular formula C25H29Cl2N3O3 and a molecular weight of 490.43 g/mol. Its IUPAC name is 6-[(5R)-5,9-diamino-4-oxononyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride.
| Compound Name | 6-[(5R)-5,9-diamino-4-oxononyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride |
|---|---|
| PubChem CID | 90664576 |
| Molecular Formula | C25H29Cl2N3O3 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 6-[(5R)-5,9-diamino-4-oxononyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCCC[C@@H](N)C(=O)CCCn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H27N3O3.2ClH/c26-14-6-5-12-20(27)21(29)13-7-15-28-23-17-9-2-3-10-18(17)24(30)22(23)16-8-1-4-11-19(16)25(28)31;;/h1-4,8-11,20H,5-7,12-15,26-27H2;2*1H/t20-;;/m1../s1 |
| InChIKey | SLAHHRDIRFNUNX-FAVHNTAZSA-N |
| XLogP | 3.86 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|