C16H16Cl2N6O — CID 90664632
5-[3-(3-carbamimidoylphenyl)-1,2-oxazol-5-yl]pyridine-2-carboximidamide;dihydrochloride (PubChem CID 90664632) has the molecular formula C16H16Cl2N6O and a molecular weight of 379.25 g/mol. Its IUPAC name is 5-[3-(3-carbamimidoylphenyl)-1,2-oxazol-5-yl]pyridine-2-carboximidamide;dihydrochloride.
| Compound Name | 5-[3-(3-carbamimidoylphenyl)-1,2-oxazol-5-yl]pyridine-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 90664632 |
| Molecular Formula | C16H16Cl2N6O |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 5-[3-(3-carbamimidoylphenyl)-1,2-oxazol-5-yl]pyridine-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1cccc(-c2cc(-c3ccc(/C(N)=N/[H])nc3)on2)c1 |
| InChI | InChI=1S/C16H14N6O.2ClH/c17-15(18)10-3-1-2-9(6-10)13-7-14(23-22-13)11-4-5-12(16(19)20)21-8-11;;/h1-8H,(H3,17,18)(H3,19,20);2*1H |
| InChIKey | AUQPEZJJMBGZPT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|