C20H26Cl2N4O — CID 90664704
N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]furan-2-carboximidamide;dihydrochloride (PubChem CID 90664704) has the molecular formula C20H26Cl2N4O and a molecular weight of 409.36 g/mol. Its IUPAC name is N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]furan-2-carboximidamide;dihydrochloride.
| Compound Name | N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]furan-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 90664704 |
| Molecular Formula | C20H26Cl2N4O |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]furan-2-carboximidamide;dihydrochloride |
| SMILES | CN1CCCC1CCn1ccc2cc(/N=C(\N)c3ccco3)ccc21.Cl.Cl |
| InChI | InChI=1S/C20H24N4O.2ClH/c1-23-10-2-4-17(23)9-12-24-11-8-15-14-16(6-7-18(15)24)22-20(21)19-5-3-13-25-19;;/h3,5-8,11,13-14,17H,2,4,9-10,12H2,1H3,(H2,21,22);2*1H |
| InChIKey | HZYGTFJRHKYUOB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|