About 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride (PubChem CID 90664725) has the molecular formula C12H17Cl2N5
and a molecular weight of 302.21 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride |
| PubChem CID | 90664725 |
| Molecular Formula | C12H17Cl2N5 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride |
| SMILES | Cc1cc2nnn(CC3=NCCN3)c2cc1C.Cl.Cl |
| InChI | InChI=1S/C12H15N5.2ClH/c1-8-5-10-11(6-9(8)2)17(16-15-10)7-12-13-3-4-14-12;;/h5-6H,3-4,7H2,1-2H3,(H,13,14);2*1H |
| InChIKey | RTPBYBYGOVBNSG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride (CID 90664725) is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride is Cc1cc2nnn(CC3=NCCN3)c2cc1C.Cl.Cl.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride?
The InChIKey is RTPBYBYGOVBNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5.2ClH/c1-8-5-10-11(6-9(8)2)17(16-15-10)7-12-13-3-4-14-12;;/h5-6H,3-4,7H2,1-2H3,(H,13,14);2*1H.
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride?
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride has a molecular weight of 302.21 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzotriazole;dihydrochloride is sourced from PubChem (CID 90664725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).