About N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride
N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride (PubChem CID 90664836) has the molecular formula C29H32Cl2N4O
and a molecular weight of 523.51 g/mol. Its IUPAC name is N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride.
Molecular Properties
| Compound Name | N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride |
| PubChem CID | 90664836 |
| Molecular Formula | C29H32Cl2N4O |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride |
| SMILES | CCCCN(CCCC)c1ccc2nc3c4ccccc4/c(=N/c4ccncc4)cc-3oc2c1.Cl.Cl |
| InChI | InChI=1S/C29H30N4O.2ClH/c1-3-5-17-33(18-6-4-2)22-11-12-25-27(19-22)34-28-20-26(31-21-13-15-30-16-14-21)23-9-7-8-10-24(23)29(28)32-25;;/h7-16,19-20H,3-6,17-18H2,1-2H3;2*1H/b31-26+;; |
| InChIKey | LDWMNHNWEKTWKR-GFUILYMMSA-N |
| XLogP | 7.96 |
| TPSA | 54.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride?
The IUPAC name of N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride (CID 90664836) is N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride.
What is the SMILES notation for N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride?
The canonical SMILES for N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride is CCCCN(CCCC)c1ccc2nc3c4ccccc4/c(=N/c4ccncc4)cc-3oc2c1.Cl.Cl.
What is the InChIKey of N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride?
The InChIKey is LDWMNHNWEKTWKR-GFUILYMMSA-N. The full InChI is InChI=1S/C29H30N4O.2ClH/c1-3-5-17-33(18-6-4-2)22-11-12-25-27(19-22)34-28-20-26(31-21-13-15-30-16-14-21)23-9-7-8-10-24(23)29(28)32-25;;/h7-16,19-20H,3-6,17-18H2,1-2H3;2*1H/b31-26+;;.
What are the key properties of N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride?
N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride has a molecular weight of 523.51 g/mol, XLogP of 7.96, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-5-pyridin-4-yliminobenzo[a]phenoxazin-9-amine;dihydrochloride is sourced from PubChem (CID 90664836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).