About 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride (PubChem CID 90664843) has the molecular formula C13H18Cl2N4
and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride |
| PubChem CID | 90664843 |
| Molecular Formula | C13H18Cl2N4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride |
| SMILES | Cc1cc2ncn(CC3=NCCN3)c2cc1C.Cl.Cl |
| InChI | InChI=1S/C13H16N4.2ClH/c1-9-5-11-12(6-10(9)2)17(8-16-11)7-13-14-3-4-15-13;;/h5-6,8H,3-4,7H2,1-2H3,(H,14,15);2*1H |
| InChIKey | NJHONFYAURKHCV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride (CID 90664843) is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride is Cc1cc2ncn(CC3=NCCN3)c2cc1C.Cl.Cl.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride?
The InChIKey is NJHONFYAURKHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4.2ClH/c1-9-5-11-12(6-10(9)2)17(8-16-11)7-13-14-3-4-15-13;;/h5-6,8H,3-4,7H2,1-2H3,(H,14,15);2*1H.
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride?
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride has a molecular weight of 301.22 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-5,6-dimethylbenzimidazole;dihydrochloride is sourced from PubChem (CID 90664843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).