About 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride (PubChem CID 90664845) has the molecular formula C12H16Cl2N4O
and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride |
| PubChem CID | 90664845 |
| Molecular Formula | C12H16Cl2N4O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride |
| SMILES | COc1cccc2c1cnn2CC1=NCCN1.Cl.Cl |
| InChI | InChI=1S/C12H14N4O.2ClH/c1-17-11-4-2-3-10-9(11)7-15-16(10)8-12-13-5-6-14-12;;/h2-4,7H,5-6,8H2,1H3,(H,13,14);2*1H |
| InChIKey | WRTDHHCGXCMSDE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride (CID 90664845) is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride is COc1cccc2c1cnn2CC1=NCCN1.Cl.Cl.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride?
The InChIKey is WRTDHHCGXCMSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O.2ClH/c1-17-11-4-2-3-10-9(11)7-15-16(10)8-12-13-5-6-14-12;;/h2-4,7H,5-6,8H2,1H3,(H,13,14);2*1H.
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride?
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride has a molecular weight of 303.19 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methoxyindazole;dihydrochloride is sourced from PubChem (CID 90664845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).