About 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride
7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride (PubChem CID 90664887) has the molecular formula C9H14Cl2N2OS
and a molecular weight of 269.20 g/mol. Its IUPAC name is 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride.
Molecular Properties
| Compound Name | 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride |
| PubChem CID | 90664887 |
| Molecular Formula | C9H14Cl2N2OS |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride |
| SMILES | CC1Nc2ccc(O)c(CN)c2S1.Cl.Cl |
| InChI | InChI=1S/C9H12N2OS.2ClH/c1-5-11-7-2-3-8(12)6(4-10)9(7)13-5;;/h2-3,5,11-12H,4,10H2,1H3;2*1H |
| InChIKey | GHVBPJQPNHBNPU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride?
The IUPAC name of 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride (CID 90664887) is 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride.
What is the SMILES notation for 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride?
The canonical SMILES for 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride is CC1Nc2ccc(O)c(CN)c2S1.Cl.Cl.
What is the InChIKey of 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride?
The InChIKey is GHVBPJQPNHBNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS.2ClH/c1-5-11-7-2-3-8(12)6(4-10)9(7)13-5;;/h2-3,5,11-12H,4,10H2,1H3;2*1H.
What are the key properties of 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride?
7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride has a molecular weight of 269.20 g/mol, XLogP of 2.56, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aminomethyl)-2-methyl-2,3-dihydro-1,3-benzothiazol-6-ol;dihydrochloride is sourced from PubChem (CID 90664887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).