C12H26Cl2N4O2S2 — CID 90664923
2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone;dihydrochloride (PubChem CID 90664923) has the molecular formula C12H26Cl2N4O2S2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 90664923 |
| Molecular Formula | C12H26Cl2N4O2S2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CS)N1CCNCCN(C(=O)CS)CCNCC1 |
| InChI | InChI=1S/C12H24N4O2S2.2ClH/c17-11(9-19)15-5-1-13-2-6-16(12(18)10-20)8-4-14-3-7-15;;/h13-14,19-20H,1-10H2;2*1H |
| InChIKey | ZGYRAJRCSXCZHE-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|