About 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride
2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride (PubChem CID 90665144) has the molecular formula C26H28Cl2N4O2
and a molecular weight of 499.44 g/mol. Its IUPAC name is 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride |
| PubChem CID | 90665144 |
| Molecular Formula | C26H28Cl2N4O2 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride |
| SMILES | Cl.Cl.N#CC(c1cccnc1)N1CCN(C(=O)OCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26N4O2.2ClH/c27-18-25(23-12-7-13-28-19-23)29-14-16-30(17-15-29)26(31)32-20-24(21-8-3-1-4-9-21)22-10-5-2-6-11-22;;/h1-13,19,24-25H,14-17,20H2;2*1H |
| InChIKey | VEFMKRAVEQDGNW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride?
The IUPAC name of 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride (CID 90665144) is 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride.
What is the SMILES notation for 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride?
The canonical SMILES for 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride is Cl.Cl.N#CC(c1cccnc1)N1CCN(C(=O)OCC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride?
The InChIKey is VEFMKRAVEQDGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O2.2ClH/c27-18-25(23-12-7-13-28-19-23)29-14-16-30(17-15-29)26(31)32-20-24(21-8-3-1-4-9-21)22-10-5-2-6-11-22;;/h1-13,19,24-25H,14-17,20H2;2*1H.
What are the key properties of 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride?
2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride has a molecular weight of 499.44 g/mol, XLogP of 5.08, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenylethyl 4-[cyano(pyridin-3-yl)methyl]piperazine-1-carboxylate;dihydrochloride is sourced from PubChem (CID 90665144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).