About 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride
7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride (PubChem CID 90665184) has the molecular formula C16H17Cl4N3
and a molecular weight of 393.15 g/mol. Its IUPAC name is 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride.
Molecular Properties
| Compound Name | 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride |
| PubChem CID | 90665184 |
| Molecular Formula | C16H17Cl4N3 |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride |
| SMILES | Cl.Cl.Cl.Nc1nccc2ccc(NCc3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C16H14ClN3.3ClH/c17-13-4-1-11(2-5-13)10-20-14-6-3-12-7-8-19-16(18)15(12)9-14;;;/h1-9,20H,10H2,(H2,18,19);3*1H |
| InChIKey | PYHTYFNHZWXFTR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride?
The IUPAC name of 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride (CID 90665184) is 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride.
What is the SMILES notation for 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride?
The canonical SMILES for 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride is Cl.Cl.Cl.Nc1nccc2ccc(NCc3ccc(Cl)cc3)cc12.
What is the InChIKey of 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride?
The InChIKey is PYHTYFNHZWXFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3.3ClH/c17-13-4-1-11(2-5-13)10-20-14-6-3-12-7-8-19-16(18)15(12)9-14;;;/h1-9,20H,10H2,(H2,18,19);3*1H.
What are the key properties of 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride?
7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride has a molecular weight of 393.15 g/mol, XLogP of 5.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N-[(4-chlorophenyl)methyl]isoquinoline-1,7-diamine;trihydrochloride is sourced from PubChem (CID 90665184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).