C20H21Cl2N5 — CID 90665224
4-[3-amino-5-(4-carbamimidoylphenyl)phenyl]benzenecarboximidamide;dihydrochloride (PubChem CID 90665224) has the molecular formula C20H21Cl2N5 and a molecular weight of 402.33 g/mol. Its IUPAC name is 4-[3-amino-5-(4-carbamimidoylphenyl)phenyl]benzenecarboximidamide;dihydrochloride.
| Compound Name | 4-[3-amino-5-(4-carbamimidoylphenyl)phenyl]benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 90665224 |
| Molecular Formula | C20H21Cl2N5 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-[3-amino-5-(4-carbamimidoylphenyl)phenyl]benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(-c2cc(N)cc(-c3ccc(/C(N)=N/[H])cc3)c2)cc1 |
| InChI | InChI=1S/C20H19N5.2ClH/c21-18-10-16(12-1-5-14(6-2-12)19(22)23)9-17(11-18)13-3-7-15(8-4-13)20(24)25;;/h1-11H,21H2,(H3,22,23)(H3,24,25);2*1H |
| InChIKey | UGNQZKLMUIKBGD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|