C9H14N4O4 — CID 90665271
1-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-1,2,4-triazole-3-carboxamide (PubChem CID 90665271) has the molecular formula C9H14N4O4 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 90665271 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn([C@H]2C[C@@H](CO)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C9H14N4O4/c10-8(17)9-11-3-13(12-9)5-1-4(2-14)6(15)7(5)16/h3-7,14-16H,1-2H2,(H2,10,17)/t4-,5-,6-,7+/m0/s1 |
| InChIKey | PKSOPVRXFYTKEO-ZTYPAOSTSA-N |
| XLogP | -2.35 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |