C33H39N7O4 — CID 90665793
2-[3-[(3S,6S,10S,13S)-6-benzyl-10-naphthalen-1-yl-2,5,8,12-tetraoxo-1,4,7,11-tetrazabicyclo[11.3.0]hexadecan-3-yl]propyl]guanidine (PubChem CID 90665793) has the molecular formula C33H39N7O4 and a molecular weight of 597.72 g/mol. Its IUPAC name is 2-[3-[(3S,6S,10S,13S)-6-benzyl-10-naphthalen-1-yl-2,5,8,12-tetraoxo-1,4,7,11-tetrazabicyclo[11.3.0]hexadecan-3-yl]propyl]guanidine.
| Compound Name | 2-[3-[(3S,6S,10S,13S)-6-benzyl-10-naphthalen-1-yl-2,5,8,12-tetraoxo-1,4,7,11-tetrazabicyclo[11.3.0]hexadecan-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 90665793 |
| Molecular Formula | C33H39N7O4 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 2-[3-[(3S,6S,10S,13S)-6-benzyl-10-naphthalen-1-yl-2,5,8,12-tetraoxo-1,4,7,11-tetrazabicyclo[11.3.0]hexadecan-3-yl]propyl]guanidine |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)C[C@@H](c2cccc3ccccc23)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C33H39N7O4/c34-33(35)36-17-7-15-25-32(44)40-18-8-16-28(40)31(43)39-26(24-14-6-12-22-11-4-5-13-23(22)24)20-29(41)37-27(30(42)38-25)19-21-9-2-1-3-10-21/h1-6,9-14,25-28H,7-8,15-20H2,(H,37,41)(H,38,42)(H,39,43)(H4,34,35,36)/t25-,26-,27-,28-/m0/s1 |
| InChIKey | RXHGGONPLCYJAD-LJWNLINESA-N |
| XLogP | 1.66 |
| TPSA | 172.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|