C23H37N3O6S2 — CID 90665809
(1S,5S,6R,9S,15E,20R)-20-butyl-5-hydroxy-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone (PubChem CID 90665809) has the molecular formula C23H37N3O6S2 and a molecular weight of 515.70 g/mol. Its IUPAC name is (1S,5S,6R,9S,15E,20R)-20-butyl-5-hydroxy-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone.
| Compound Name | (1S,5S,6R,9S,15E,20R)-20-butyl-5-hydroxy-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
|---|---|
| PubChem CID | 90665809 |
| Molecular Formula | C23H37N3O6S2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | (1S,5S,6R,9S,15E,20R)-20-butyl-5-hydroxy-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
| SMILES | CCCC[C@H]1NC(=O)C[C@H]2/C=C/CCSSCC(NC1=O)C(=O)N[C@H](C(C)C)[C@@H](O)CC(=O)O2 |
| InChI | InChI=1S/C23H37N3O6S2/c1-4-5-9-16-22(30)25-17-13-34-33-10-7-6-8-15(11-19(28)24-16)32-20(29)12-18(27)21(14(2)3)26-23(17)31/h6,8,14-18,21,27H,4-5,7,9-13H2,1-3H3,(H,24,28)(H,25,30)(H,26,31)/b8-6+/t15-,16-,17?,18+,21-/m1/s1 |
| InChIKey | DLMNFMQRIXCIAK-FJZDKXBOSA-N |
| XLogP | 1.69 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|