C27H32ClN7O2 — CID 90665988
(1S,2S,3R,4R)-3-[[6-chloro-2-[2-methoxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 90665988) has the molecular formula C27H32ClN7O2 and a molecular weight of 522.05 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[6-chloro-2-[2-methoxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[6-chloro-2-[2-methoxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 90665988 |
| Molecular Formula | C27H32ClN7O2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[6-chloro-2-[2-methoxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1cc(CN2CCN(C)CC2)ccc1-c1nc2ncc(Cl)c(N[C@H]3[C@@H](C(N)=O)[C@@H]4C=C[C@H]3C4)c2[nH]1 |
| InChI | InChI=1S/C27H32ClN7O2/c1-34-7-9-35(10-8-34)14-15-3-6-18(20(11-15)37-2)26-32-24-23(19(28)13-30-27(24)33-26)31-22-17-5-4-16(12-17)21(22)25(29)36/h3-6,11,13,16-17,21-22H,7-10,12,14H2,1-2H3,(H2,29,36)(H2,30,31,32,33)/t16-,17+,21+,22-/m1/s1 |
| InChIKey | CAIAMTHZGVFCNA-XKPGHWPRSA-N |
| XLogP | 3.12 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|