C21H19FN4O4 — CID 90666175
7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-methoxyethyl)-2-oxo-1H-pyrrolo[2,3-c][1,5]naphthyridine-3-carboxamide (PubChem CID 90666175) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-methoxyethyl)-2-oxo-1H-pyrrolo[2,3-c][1,5]naphthyridine-3-carboxamide.
| Compound Name | 7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-methoxyethyl)-2-oxo-1H-pyrrolo[2,3-c][1,5]naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 90666175 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-methoxyethyl)-2-oxo-1H-pyrrolo[2,3-c][1,5]naphthyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1c(O)c2ncc3c(ccn3Cc3ccc(F)cc3)c2[nH]c1=O |
| InChI | InChI=1S/C21H19FN4O4/c1-30-9-7-23-20(28)16-19(27)18-17(25-21(16)29)14-6-8-26(15(14)10-24-18)11-12-2-4-13(22)5-3-12/h2-6,8,10H,7,9,11H2,1H3,(H,23,28)(H2,25,27,29) |
| InChIKey | VRJUUCOUYWMCDE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|