About 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one
3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one (PubChem CID 90666180) has the molecular formula C16H10O7
and a molecular weight of 314.25 g/mol. Its IUPAC name is 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one |
| PubChem CID | 90666180 |
| Molecular Formula | C16H10O7 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one |
| SMILES | O=C(c1ccc(O)c(O)c1)c1cc2c(O)cc(O)cc2oc1=O |
| InChI | InChI=1S/C16H10O7/c17-8-4-12(19)9-6-10(16(22)23-14(9)5-8)15(21)7-1-2-11(18)13(20)3-7/h1-6,17-20H |
| InChIKey | QTPJEQAAZDUPJW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one?
The IUPAC name of 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one (CID 90666180) is 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one.
What is the SMILES notation for 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one?
The canonical SMILES for 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one is O=C(c1ccc(O)c(O)c1)c1cc2c(O)cc(O)cc2oc1=O.
What is the InChIKey of 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one?
The InChIKey is QTPJEQAAZDUPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O7/c17-8-4-12(19)9-6-10(16(22)23-14(9)5-8)15(21)7-1-2-11(18)13(20)3-7/h1-6,17-20H.
What are the key properties of 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one?
3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one has a molecular weight of 314.25 g/mol, XLogP of 1.85, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydroxybenzoyl)-5,7-dihydroxychromen-2-one is sourced from PubChem (CID 90666180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).