About 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole
1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole (PubChem CID 90666248) has the molecular formula C28H28F2N4O2
and a molecular weight of 490.55 g/mol. Its IUPAC name is 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole.
Molecular Properties
| Compound Name | 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole |
| PubChem CID | 90666248 |
| Molecular Formula | C28H28F2N4O2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole |
| SMILES | O=[N+]([O-])c1ccc2c(cnn2C2CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C28H28F2N4O2/c29-23-7-3-20(4-8-23)27(21-5-9-24(30)10-6-21)2-1-15-32-16-13-25(14-17-32)33-28-12-11-26(34(35)36)18-22(28)19-31-33/h3-12,18-19,25,27H,1-2,13-17H2 |
| InChIKey | JDHFGRDIBVIKTN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole?
The IUPAC name of 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole (CID 90666248) is 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole.
What is the SMILES notation for 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole?
The canonical SMILES for 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole is O=[N+]([O-])c1ccc2c(cnn2C2CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1.
What is the InChIKey of 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole?
The InChIKey is JDHFGRDIBVIKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28F2N4O2/c29-23-7-3-20(4-8-23)27(21-5-9-24(30)10-6-21)2-1-15-32-16-13-25(14-17-32)33-28-12-11-26(34(35)36)18-22(28)19-31-33/h3-12,18-19,25,27H,1-2,13-17H2.
What are the key properties of 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole?
1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole has a molecular weight of 490.55 g/mol, XLogP of 6.47, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-5-nitroindazole is sourced from PubChem (CID 90666248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).