About 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol
1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol (PubChem CID 90666441) has the molecular formula C15H14N2O3S
and a molecular weight of 302.36 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol.
Molecular Properties
| Compound Name | 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol |
| PubChem CID | 90666441 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol |
| SMILES | CC(O)c1cc2cccnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O3S/c1-11(18)14-10-12-6-5-9-16-15(12)17(14)21(19,20)13-7-3-2-4-8-13/h2-11,18H,1H3 |
| InChIKey | JSYGCTKFUQHNOL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol?
The IUPAC name of 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol (CID 90666441) is 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol.
What is the SMILES notation for 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol?
The canonical SMILES for 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol is CC(O)c1cc2cccnc2n1S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol?
The InChIKey is JSYGCTKFUQHNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3S/c1-11(18)14-10-12-6-5-9-16-15(12)17(14)21(19,20)13-7-3-2-4-8-13/h2-11,18H,1H3.
What are the key properties of 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol?
1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol has a molecular weight of 302.36 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol is sourced from PubChem (CID 90666441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).